CAS 1076198-86-1 appears in our catalog under these names: 7-Aminosuccinylbenzo[a]pyrene, 98%, 7-Aminosuccinylbenzo(a)pyrene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
4-(benzo[a]pyren-7-ylamino)-4-oxobutanoic acid (CAS 1076198-86-1) is a chemical compound with the molecular formula C24H17NO3 and a molecular weight of 367.4 g/mol. IUPAC name: 4-(benzo[a]pyren-7-ylamino)-4-oxobutanoic acid. InChIKey: MSMUODXDXXPYJQ-UHFFFAOYSA-N.
| Molecular formula | C24H17NO3 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 4-(benzo[a]pyren-7-ylamino)-4-oxobutanoic acid |
| InChIKey | MSMUODXDXXPYJQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C3C(=CC5=C4C=CC=C5NC(=O)CCC(=O)O)C=C2 |
Computed by PubChem (NCBI)