CAS 1076199-46-6 is the registry number for Citalopram Impurity 37. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoro-N-methylacetamide (CAS 1076199-46-6) is a chemical compound with the molecular formula C21H18F4N2O2 and a molecular weight of 406.4 g/mol. IUPAC name: N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoro-N-methylacetamide. InChIKey: AIVUSJIHPDCSPS-UHFFFAOYSA-N.
| Molecular formula | C21H18F4N2O2 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | N-[3-[5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]propyl]-2,2,2-trifluoro-N-methylacetamide |
| InChIKey | AIVUSJIHPDCSPS-UHFFFAOYSA-N |
| SMILES | CN(CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)