CAS 1076199-48-8 is the registry number for N-Trifluoroacetyl Alendronic Acid. Offered by: TRC. Available pack sizes: 750mg.
[1-hydroxy-1-phosphono-4-[(2,2,2-trifluoroacetyl)amino]butyl]phosphonic acid (CAS 1076199-48-8) is a chemical compound with the molecular formula C6H12F3NO8P2 and a molecular weight of 345.10 g/mol. IUPAC name: [1-hydroxy-1-phosphono-4-[(2,2,2-trifluoroacetyl)amino]butyl]phosphonic acid. InChIKey: GDRCTQDHXBOUOA-UHFFFAOYSA-N.
| Molecular formula | C6H12F3NO8P2 |
|---|---|
| Molecular weight | 345.10 g/mol |
| IUPAC name | [1-hydroxy-1-phosphono-4-[(2,2,2-trifluoroacetyl)amino]butyl]phosphonic acid |
| InChIKey | GDRCTQDHXBOUOA-UHFFFAOYSA-N |
| SMILES | C(CC(O)(P(=O)(O)O)P(=O)(O)O)CNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)