Products 1076199-92-2
CAS 1076199-92-2 appears in our catalog under these names: 2-Cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethanamine, Venlafaxine EP Impurity G, Venlafaxine Impurity 7（Venlafaxine EP Impurity G）, Deoxy Venlafaxine, >95% (HPLC), DEOXY VENLAFAXINE. Offered by: Biosynth, Chemat Brand, Hubei YoungXin, TRC, Sigma-Aldrich. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg, on request, 50mg, 100mg.
2-cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethanamine (CAS 1076199-92-2) is a chemical compound with the molecular formula C17H27NO and a molecular weight of 261.4 g/mol. IUPAC name: 2-cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethanamine. InChIKey: RELISZWQPGCXDE-UHFFFAOYSA-N.
| Molecular formula | C17H27NO |
|---|---|
| Molecular weight | 261.4 g/mol |
| IUPAC name | 2-cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethanamine |
| InChIKey | RELISZWQPGCXDE-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1CCCCC1)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)
Synonyms:
Deoxy Venlafaxine, Deoxyvenlafaxine, 2-Cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethylamine, (2RS)-2-Cyclohexyl-2-(4-methoxyphenyl)-N,N-dimethylethanamine, Venlafaxine hydrochloride impurity G [EP], Benzeneethanamine, beta-cyclohexyl-4-methoxy-N,N-dimethyl-, VENLAFAXINE HYDROCHLORIDE IMPURITY G [EP IMPURITY], VENLAFAXINE HYDROCHLORIDE IMPURITY G (EP IMPURITY), VENLAFAXINE HYDROCHLORIDE IMPURITY, DEOXY VENLAFAXINE-(USP IMPURITY), VENLAFAXINE HYDROCHLORIDE IMPURITY, DEOXY VENLAFAXINE-[USP IMPURITY]