CAS 1076200-01-5 appears in our catalog under these names: 2,3-Diethyl-5-methylpyrazine-N4-oxide, 2,3-Diethyl-5-methylpyrazine-N4-oxide, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 10mg, on request.
2,3-diethyl-6-methyl-1-oxidopyrazin-1-ium (CAS 1076200-01-5) is a chemical compound with the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. IUPAC name: 2,3-diethyl-6-methyl-1-oxidopyrazin-1-ium. InChIKey: ZRZIYDSIPJMJJT-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O |
|---|---|
| Molecular weight | 166.22 g/mol |
| IUPAC name | 2,3-diethyl-6-methyl-1-oxidopyrazin-1-ium |
| InChIKey | ZRZIYDSIPJMJJT-UHFFFAOYSA-N |
| SMILES | CCC1=NC=C([N+](=C1CC)[O-])C |
Computed by PubChem (NCBI)