CAS 107632-22-4 appears in our catalog under these names: Disodium Deuterium Phosphate, 98 atom % D, min 98% Chemical Purity, Phosphate dibasic-d1(sodium), 99.0%. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 5 mg, 50 mg, 25 mg, 100 mg, 10 mg.
Disodium;deuterio phosphate (CAS 107632-22-4) is a chemical compound with the molecular formula HNa2O4P and a molecular weight of 142.965 g/mol. IUPAC name: disodium;deuterio phosphate. InChIKey: BNIILDVGGAEEIG-DYCDLGHISA-L.
| Molecular formula | HNa2O4P |
|---|---|
| Molecular weight | 142.965 g/mol |
| IUPAC name | disodium;deuterio phosphate |
| InChIKey | BNIILDVGGAEEIG-DYCDLGHISA-L |
| SMILES | [2H]OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)