CAS 107643-76-5 appears in our catalog under these names: 5,10,15,20-Tetrakis(3-iodophenyl)porphyrin, 98%, 5,10,15,20–Tetrakis(3–iodophenyl)porphyrin. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
5,10,15,20-tetrakis(3-iodophenyl)-21,23-dihydroporphyrin (CAS 107643-76-5) is a chemical compound with the molecular formula C44H26I4N4 and a molecular weight of 1118.3 g/mol. IUPAC name: 5,10,15,20-tetrakis(3-iodophenyl)-21,23-dihydroporphyrin. InChIKey: BIHWRSWVZVTYDW-UHFFFAOYSA-N.
| Molecular formula | C44H26I4N4 |
|---|---|
| Molecular weight | 1118.3 g/mol |
| IUPAC name | 5,10,15,20-tetrakis(3-iodophenyl)-21,23-dihydroporphyrin |
| InChIKey | BIHWRSWVZVTYDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC(=CC=C7)I)C8=CC(=CC=C8)I)C=C4)C9=CC(=CC=C9)I)N3 |
Computed by PubChem (NCBI)