CAS 107675-95-6 is the registry number for (1,2-Cyclopentanediamine-N,N')[3-nitro-1,2-benzenedicarboxylato(2-)-O1,O2]platinum, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopentane-1,2-diamine;3-nitrophthalate;platinum(2+) (CAS 107675-95-6) is a chemical compound with the molecular formula C13H15N3O6Pt and a molecular weight of 504.36 g/mol. IUPAC name: cyclopentane-1,2-diamine;3-nitrophthalate;platinum(2+). InChIKey: JSHMYJYACIPMKA-UHFFFAOYSA-L.
| Molecular formula | C13H15N3O6Pt |
|---|---|
| Molecular weight | 504.36 g/mol |
| IUPAC name | cyclopentane-1,2-diamine;3-nitrophthalate;platinum(2+) |
| InChIKey | JSHMYJYACIPMKA-UHFFFAOYSA-L |
| SMILES | C1CC(C(C1)N)N.C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)[O-])C(=O)[O-].[Pt+2] |
Computed by PubChem (NCBI)