Products 107707-38-0
CAS 107707-38-0 is the registry number for RS-87337. Offered by: MedChemExpress. Available pack sizes: Get quote.
N'-(3,5-dichlorophenyl)-4-(4-hydroxy-2-methoxyphenyl)piperazine-1-carboximidamide (CAS 107707-38-0) is a chemical compound with the molecular formula C18H20Cl2N4O2 and a molecular weight of 395.3 g/mol. IUPAC name: N'-(3,5-dichlorophenyl)-4-(4-hydroxy-2-methoxyphenyl)piperazine-1-carboximidamide. InChIKey: HBGHJWNGKZSGQY-UHFFFAOYSA-N.
| Molecular formula | C18H20Cl2N4O2 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | N'-(3,5-dichlorophenyl)-4-(4-hydroxy-2-methoxyphenyl)piperazine-1-carboximidamide |
| InChIKey | HBGHJWNGKZSGQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)O)N2CCN(CC2)C(=NC3=CC(=CC(=C3)Cl)Cl)N |
Computed by PubChem (NCBI)