CAS 1078160-58-3 appears in our catalog under these names: N-(3,5-Dimethyl-1H-pyrazol-4-yl)-2-(methylamino)acetamide hydrochloride, 95%, N-(3,5-Dimethyl-1H-pyrazol-4-yl)-2-(methylamino)acetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(methylamino)acetamide;hydrochloride (CAS 1078160-58-3) is a chemical compound with the molecular formula C8H15ClN4O and a molecular weight of 218.68 g/mol. IUPAC name: N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(methylamino)acetamide;hydrochloride. InChIKey: ZGNYSYPRPXBICT-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN4O |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | ZGNYSYPRPXBICT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)NC(=O)CNC.Cl |
Computed by PubChem (NCBI)