CAS 1078163-25-3 appears in our catalog under these names: N-(2,4-Dichlorophenyl)piperidine-2-carboxamide hydrochloride, 95%, N-(2,4-Dichlorophenyl)piperidine-2-carboxamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(2,4-dichlorophenyl)piperidine-2-carboxamide;hydrochloride (CAS 1078163-25-3) is a chemical compound with the molecular formula C12H15Cl3N2O and a molecular weight of 309.6 g/mol. IUPAC name: N-(2,4-dichlorophenyl)piperidine-2-carboxamide;hydrochloride. InChIKey: YZPUZBGYGCNALA-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl3N2O |
|---|---|
| Molecular weight | 309.6 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)piperidine-2-carboxamide;hydrochloride |
| InChIKey | YZPUZBGYGCNALA-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C(=O)NC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)