Products 107825-28-5

CAS 107825-28-5 is the registry number for Etoricoxib Impurity 39. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(4-methylsulfanylphenyl)-1-morpholin-4-ylethanethione (CAS 107825-28-5) is a chemical compound with the molecular formula C13H17NOS2 and a molecular weight of 267.4 g/mol. IUPAC name: 2-(4-methylsulfanylphenyl)-1-morpholin-4-ylethanethione. InChIKey: QTBUBEBGUVJXIN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NOS2
Molecular weight267.4 g/mol
IUPAC name2-(4-methylsulfanylphenyl)-1-morpholin-4-ylethanethione
InChIKeyQTBUBEBGUVJXIN-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)CC(=S)N2CCOCC2

Computed by PubChem (NCBI)