Products 107831-79-8

CAS 107831-79-8 is the registry number for L-Valine chloromethyl ketone hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride (CAS 107831-79-8) is a chemical compound with the molecular formula C6H13Cl2NO and a molecular weight of 186.08 g/mol. IUPAC name: (3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride. InChIKey: UYCJMRLNPAXBJE-RGMNGODLSA-N.

Identity
Molecular formulaC6H13Cl2NO
Molecular weight186.08 g/mol
IUPAC name(3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride
InChIKeyUYCJMRLNPAXBJE-RGMNGODLSA-N
SMILESCC(C)[C@@H](C(=O)CCl)N.Cl

Computed by PubChem (NCBI)