CAS 107831-79-8 is the registry number for L-Valine chloromethyl ketone hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride (CAS 107831-79-8) is a chemical compound with the molecular formula C6H13Cl2NO and a molecular weight of 186.08 g/mol. IUPAC name: (3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride. InChIKey: UYCJMRLNPAXBJE-RGMNGODLSA-N.
| Molecular formula | C6H13Cl2NO |
|---|---|
| Molecular weight | 186.08 g/mol |
| IUPAC name | (3S)-3-amino-1-chloro-4-methylpentan-2-one;hydrochloride |
| InChIKey | UYCJMRLNPAXBJE-RGMNGODLSA-N |
| SMILES | CC(C)[C@@H](C(=O)CCl)N.Cl |
Computed by PubChem (NCBI)