CAS 107849-54-7 appears in our catalog under these names: Levothyroxine Impurity 21, Thyroxine Impurity 1, Levothyroxine Impurity 17, Beta-Hydroxy Thyroxine (>90%), β-Hydroxy thyroxine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
(2S)-2-amino-3-hydroxy-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid (CAS 107849-54-7) is a chemical compound with the molecular formula C15H11I4NO5 and a molecular weight of 792.87 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid. InChIKey: QIFVILYTCIFAPL-PXYINDEMSA-N.
| Molecular formula | C15H11I4NO5 |
|---|---|
| Molecular weight | 792.87 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]propanoic acid |
| InChIKey | QIFVILYTCIFAPL-PXYINDEMSA-N |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C([C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)