CAS 1078611-11-6 is the registry number for O-[(Aminoiminomethyl)amino]homoserine sulfate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid (CAS 1078611-11-6) is a chemical compound with the molecular formula C5H14N4O7S and a molecular weight of 274.26 g/mol. IUPAC name: 2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid. InChIKey: MVIPJKVMOKFIEV-UHFFFAOYSA-N.
| Molecular formula | C5H14N4O7S |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | 2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid |
| InChIKey | MVIPJKVMOKFIEV-UHFFFAOYSA-N |
| SMILES | C(CON=C(N)N)C(C(=O)O)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)