Products 1078611-11-6

CAS 1078611-11-6 is the registry number for O-[(Aminoiminomethyl)amino]homoserine sulfate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid (CAS 1078611-11-6) is a chemical compound with the molecular formula C5H14N4O7S and a molecular weight of 274.26 g/mol. IUPAC name: 2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid. InChIKey: MVIPJKVMOKFIEV-UHFFFAOYSA-N.

Identity
Molecular formulaC5H14N4O7S
Molecular weight274.26 g/mol
IUPAC name2-amino-4-(diaminomethylideneamino)oxybutanoic acid;sulfuric acid
InChIKeyMVIPJKVMOKFIEV-UHFFFAOYSA-N
SMILESC(CON=C(N)N)C(C(=O)O)N.OS(=O)(=O)O

Computed by PubChem (NCBI)