CAS 107884-20-8 is the registry number for Enrofloxacin Methyl Ester. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
Methyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate (CAS 107884-20-8) is a chemical compound with the molecular formula C20H24FN3O3 and a molecular weight of 373.4 g/mol. IUPAC name: methyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate. InChIKey: KLSZQCAZOHYUSV-UHFFFAOYSA-N.
| Molecular formula | C20H24FN3O3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | methyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate |
| InChIKey | KLSZQCAZOHYUSV-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)OC)C4CC4)F |
Computed by PubChem (NCBI)