Products 107884-20-8

CAS 107884-20-8 is the registry number for Enrofloxacin Methyl Ester. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.

Structural formula: {0} (CAS {1})

Methyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate (CAS 107884-20-8) is a chemical compound with the molecular formula C20H24FN3O3 and a molecular weight of 373.4 g/mol. IUPAC name: methyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate. InChIKey: KLSZQCAZOHYUSV-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24FN3O3
Molecular weight373.4 g/mol
IUPAC namemethyl 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate
InChIKeyKLSZQCAZOHYUSV-UHFFFAOYSA-N
SMILESCCN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)OC)C4CC4)F

Computed by PubChem (NCBI)