Products 107889-31-6
CAS 107889-31-6 is the registry number for LY256548. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one (CAS 107889-31-6) is a chemical compound with the molecular formula C19H27NO2S and a molecular weight of 333.5 g/mol. IUPAC name: (5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one. InChIKey: IXCMEASJCGKKQS-GDNBJRDFSA-N.
| Molecular formula | C19H27NO2S |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | (5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-4-one |
| InChIKey | IXCMEASJCGKKQS-GDNBJRDFSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C\2/C(=O)N(CS2)C |
Computed by PubChem (NCBI)