CAS 107920-20-7 is the registry number for 4-Isothiocyanato-n-(2-methylphenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-isothiocyanato-N-(2-methylphenyl)benzenesulfonamide (CAS 107920-20-7) is a chemical compound with the molecular formula C14H12N2O2S2 and a molecular weight of 304.4 g/mol. IUPAC name: 4-isothiocyanato-N-(2-methylphenyl)benzenesulfonamide. InChIKey: VAALPGNGGFUCSA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2S2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 4-isothiocyanato-N-(2-methylphenyl)benzenesulfonamide |
| InChIKey | VAALPGNGGFUCSA-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NS(=O)(=O)C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)