Products 1079264-82-6
CAS 1079264-82-6 is the registry number for 2-Chloro-N-[5-(dimethylamino)-2-nitrophenyl]-5-nitrobenzamide, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-N-[5-(dimethylamino)-2-nitrophenyl]-5-nitrobenzamide (CAS 1079264-82-6) is a chemical compound with the molecular formula C15H13ClN4O5 and a molecular weight of 364.74 g/mol. IUPAC name: 2-chloro-N-[5-(dimethylamino)-2-nitrophenyl]-5-nitrobenzamide. InChIKey: JTQOKCPNKYNVIR-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN4O5 |
|---|---|
| Molecular weight | 364.74 g/mol |
| IUPAC name | 2-chloro-N-[5-(dimethylamino)-2-nitrophenyl]-5-nitrobenzamide |
| InChIKey | JTQOKCPNKYNVIR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)[N+](=O)[O-])NC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)