CAS 107971-06-2 is the registry number for 3-(Aminocarbonyl)-1,6-dimethyl-pyridinium iodide. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
1,6-dimethylpyridin-1-ium-3-carboxamide iodide (CAS 107971-06-2) is a chemical compound with the molecular formula C8H11IN2O and a molecular weight of 278.09 g/mol. IUPAC name: 1,6-dimethylpyridin-1-ium-3-carboxamide iodide. InChIKey: KOYKWASDKDIQFH-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O |
|---|---|
| Molecular weight | 278.09 g/mol |
| IUPAC name | 1,6-dimethylpyridin-1-ium-3-carboxamide iodide |
| InChIKey | KOYKWASDKDIQFH-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C(C=C1)C(=O)N)C.[I-] |
Computed by PubChem (NCBI)