Products 107983-79-9
CAS 107983-79-9 is the registry number for (1S,3S)-3-Hydroxycyclopentanecarboxylic acid, 98+%. Offered by: AmBeed. Available pack sizes: 5g.
Trans-(1S,3S)-3-hydroxycyclopentane-1-carboxylic acid (CAS 107983-79-9) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: trans-(1S,3S)-3-hydroxycyclopentane-1-carboxylic acid. InChIKey: XWWQLKYMTLWXKN-WHFBIAKZSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | trans-(1S,3S)-3-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | XWWQLKYMTLWXKN-WHFBIAKZSA-N |
| SMILES | C1C[C@@H](C[C@H]1C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(1S,3S)-3-hydroxycyclopentane-1-carboxylic acid, (1S,3S)-3-Hydroxycyclopentanecarboxylic acid, Cyclopentanecarboxylic acid, 3-hydroxy-, (1S-trans)-, (1S,3S)-3-Hydroxycyclopentanecarboxylicacid, (1S,3S)3-hydroxycyclopentanecarboxylic acid, Cyclopentanecarboxylicacid, 3-hydroxy-, (1S-cis)- (9CI)