CAS 1080-43-9 is the registry number for Dimethyldiphenyltin, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Dimethyl(diphenyl)stannane (CAS 1080-43-9) is a chemical compound with the molecular formula C14H16Sn and a molecular weight of 302.99 g/mol. IUPAC name: dimethyl(diphenyl)stannane. InChIKey: INCQQSKGFIBXAY-UHFFFAOYSA-N.
| Molecular formula | C14H16Sn |
|---|---|
| Molecular weight | 302.99 g/mol |
| IUPAC name | dimethyl(diphenyl)stannane |
| InChIKey | INCQQSKGFIBXAY-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)