CAS 108005-94-3 appears in our catalog under these names: Cathepsin L–IN–2, (Rac)-Z-Phe-Phe-FMK/ 98.27% (existing batch purity), Cathepsin L-IN-2, 98.27% ,, 98.27% ,, Cathepsin L Inhibitor I 1PC X 1MG, Cathepsin L-IN-2, 98.02%. Offered by: GLPBio, TargetMol, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1mg, 5 mg, 1 mg, 25 mg, 10 mg, 10mM/1mL.
Benzyl N-[1-[(4-fluoro-3-oxo-1-phenylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (CAS 108005-94-3) is a chemical compound with the molecular formula C27H27FN2O4 and a molecular weight of 462.5 g/mol. IUPAC name: benzyl N-[1-[(4-fluoro-3-oxo-1-phenylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate. InChIKey: CAILNONEKASNSH-UHFFFAOYSA-N.
| Molecular formula | C27H27FN2O4 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | benzyl N-[1-[(4-fluoro-3-oxo-1-phenylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| InChIKey | CAILNONEKASNSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)CF)NC(=O)C(CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)