CAS 108030-77-9 is the registry number for Penclomedine. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine (CAS 108030-77-9) is a chemical compound with the molecular formula C8H6Cl5NO2 and a molecular weight of 325.4 g/mol. IUPAC name: 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine. InChIKey: DZVPGIORVGSQMC-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl5NO2 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine |
| InChIKey | DZVPGIORVGSQMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=C1Cl)OC)C(Cl)(Cl)Cl)Cl |
Computed by PubChem (NCBI)