Products 1080623-12-6
CAS 1080623-12-6 is the registry number for VUF10497. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-chloro-2-(4-methylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine (CAS 1080623-12-6) is a chemical compound with the molecular formula C18H20ClN5S and a molecular weight of 373.9 g/mol. IUPAC name: 6-chloro-2-(4-methylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine. InChIKey: OLJSGKYQYTWQNJ-UHFFFAOYSA-N.
| Molecular formula | C18H20ClN5S |
|---|---|
| Molecular weight | 373.9 g/mol |
| IUPAC name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-(thiophen-2-ylmethyl)quinazolin-4-amine |
| InChIKey | OLJSGKYQYTWQNJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC3=C(C=C(C=C3)Cl)C(=N2)NCC4=CC=CS4 |
Computed by PubChem (NCBI)