CAS 1080650-04-9 is the registry number for 4,6-Diisopropylpyrimidin-2(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,6-di(propan-2-yl)-1H-pyrimidin-2-one (CAS 1080650-04-9) is a chemical compound with the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. IUPAC name: 4,6-di(propan-2-yl)-1H-pyrimidin-2-one. InChIKey: ZMZZIYWIPKNTRI-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O |
|---|---|
| Molecular weight | 180.25 g/mol |
| IUPAC name | 4,6-di(propan-2-yl)-1H-pyrimidin-2-one |
| InChIKey | ZMZZIYWIPKNTRI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=O)N1)C(C)C |
Computed by PubChem (NCBI)