CAS 108084-47-5 appears in our catalog under these names: 4-Aminophenyl phosphate monosodium salt hydrate, 95%, 4–Aminophenyl Phosphate (sodium salt), 4-Aminophenyl phosphate monosodium salt hydrate, 4-Aminophenylphosphate sodium salt, Sodium 4-aminophenyl hydrogenphosphate 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 10mg, 50mg, 500mg, 0,5g, 2g, 5g.
Sodium;(4-aminophenyl) hydrogen phosphate;hydrate (CAS 108084-47-5) is a chemical compound with the molecular formula C6H9NNaO5P and a molecular weight of 229.10 g/mol. IUPAC name: sodium;(4-aminophenyl) hydrogen phosphate;hydrate. InChIKey: XWJZNVNMMLRLJR-UHFFFAOYSA-M.
| Molecular formula | C6H9NNaO5P |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | sodium;(4-aminophenyl) hydrogen phosphate;hydrate |
| InChIKey | XWJZNVNMMLRLJR-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1N)OP(=O)(O)[O-].O.[Na+] |
Computed by PubChem (NCBI)