CAS 108171-26-2 appears in our catalog under these names: Chloroparaffin, Chloroparaffin, 100 g, Chloroparaffin, 250 g, Chloroparaffin, 500 g. Offered by: Chemat Brand, Biosynth, Roth. Available pack sizes: on request, 250g, 100g, 500g.
2,3,4,6,7,8-hexachlorodecane (CAS 108171-26-2) is a chemical compound with the molecular formula C10H16Cl6 and a molecular weight of 348.9 g/mol. IUPAC name: 2,3,4,6,7,8-hexachlorodecane. InChIKey: ZPSFPNSXYWWGRF-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl6 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | 2,3,4,6,7,8-hexachlorodecane |
| InChIKey | ZPSFPNSXYWWGRF-UHFFFAOYSA-N |
| SMILES | CCC(C(C(CC(C(C(C)Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)