Products 1082311-02-1

CAS 1082311-02-1 appears in our catalog under these names: Indoline-5-carboxamide, 95+%, 2,3-Dihydro-1H-indole-5-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,1g, 0,05g, 0,25g, 0,5g.

2,3-dihydro-1H-indole-5-carboxamide (CAS 1082311-02-1) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. IUPAC name: 2,3-dihydro-1H-indole-5-carboxamide. InChIKey: SATOBHVAZUERBJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O
Molecular weight162.19 g/mol
IUPAC name2,3-dihydro-1H-indole-5-carboxamide
InChIKeySATOBHVAZUERBJ-UHFFFAOYSA-N
SMILESC1CNC2=C1C=C(C=C2)C(=O)N

Computed by PubChem (NCBI)