CAS 108235-80-9 is the registry number for (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarbonyl chloride 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonyl chloride (CAS 108235-80-9) is a chemical compound with the molecular formula C11H19ClO and a molecular weight of 202.72 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonyl chloride. InChIKey: XZZVZSVCQGUKOJ-KXUCPTDWSA-N.
| Molecular formula | C11H19ClO |
|---|---|
| Molecular weight | 202.72 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carbonyl chloride |
| InChIKey | XZZVZSVCQGUKOJ-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)Cl)C(C)C |
Computed by PubChem (NCBI)