CAS 1082399-51-6 appears in our catalog under these names: 1-Chloro-7-fluoro-1,2,3,4-tetrahydronaphthalene, 95%, 1-Chloro-7-fluoro-1,2,3,4-tetrahydronaphthalene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-chloro-7-fluoro-1,2,3,4-tetrahydronaphthalene (CAS 1082399-51-6) is a chemical compound with the molecular formula C10H10ClF and a molecular weight of 184.64 g/mol. IUPAC name: 1-chloro-7-fluoro-1,2,3,4-tetrahydronaphthalene. InChIKey: MVIYKNIXUJMCHJ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF |
|---|---|
| Molecular weight | 184.64 g/mol |
| IUPAC name | 1-chloro-7-fluoro-1,2,3,4-tetrahydronaphthalene |
| InChIKey | MVIYKNIXUJMCHJ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC(=C2)F)Cl |
Computed by PubChem (NCBI)