CAS 1082563-11-8 is the registry number for 1-(Aminomethyl)-6-chloro-2,3-dihydroinden-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
1-(aminomethyl)-6-chloro-2,3-dihydroinden-1-ol (CAS 1082563-11-8) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 1-(aminomethyl)-6-chloro-2,3-dihydroinden-1-ol. InChIKey: YMYYRTPMFKHNCZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 1-(aminomethyl)-6-chloro-2,3-dihydroinden-1-ol |
| InChIKey | YMYYRTPMFKHNCZ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=CC(=C2)Cl)(CN)O |
Computed by PubChem (NCBI)