Products 1082582-36-2
CAS 1082582-36-2 is the registry number for 2-Ethenylpyrazine-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-(1,2,2-trideuterioethenyl)pyrazine (CAS 1082582-36-2) is a chemical compound with the molecular formula C6H6N2 and a molecular weight of 109.14 g/mol. IUPAC name: 2-(1,2,2-trideuterioethenyl)pyrazine. InChIKey: KANZWHBYRHQMKZ-FUDHJZNOSA-N.
| Molecular formula | C6H6N2 |
|---|---|
| Molecular weight | 109.14 g/mol |
| IUPAC name | 2-(1,2,2-trideuterioethenyl)pyrazine |
| InChIKey | KANZWHBYRHQMKZ-FUDHJZNOSA-N |
| SMILES | [2H]C(=C([2H])C1=NC=CN=C1)[2H] |
Computed by PubChem (NCBI)
Synonyms:
2-Ethenylpyrazine-d3, 2-(Ethenyl-1,2,2-d3)pyrazine