CAS 1082584-90-4 appears in our catalog under these names: Ethyl 3-methyl-5-(propan-2-yl)-1,2-oxazole-4-carboxylate, 95%, 5-(tert-Butyl)-3-methylisoxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-tert-butyl-3-methyl-1,2-oxazole-4-carboxylic acid (CAS 1082584-90-4) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 5-tert-butyl-3-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: YRNJRBDONFBIIE-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 5-tert-butyl-3-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | YRNJRBDONFBIIE-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)