Products 1082605-61-5
CAS 1082605-61-5 is the registry number for TG-2-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(4-nitrophenyl)-1-[1-[(4-nitrophenyl)methyl]triazol-4-yl]prop-2-en-1-one (CAS 1082605-61-5) is a chemical compound with the molecular formula C18H13N5O5 and a molecular weight of 379.3 g/mol. IUPAC name: (E)-3-(4-nitrophenyl)-1-[1-[(4-nitrophenyl)methyl]triazol-4-yl]prop-2-en-1-one. InChIKey: CVKOJPBBOPIMAL-BJMVGYQFSA-N.
| Molecular formula | C18H13N5O5 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | (E)-3-(4-nitrophenyl)-1-[1-[(4-nitrophenyl)methyl]triazol-4-yl]prop-2-en-1-one |
| InChIKey | CVKOJPBBOPIMAL-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(N=N2)C(=O)/C=C/C3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)