Products 1082710-41-5
CAS 1082710-41-5 is the registry number for 1-(4-Aminophenyl)-2-(tert-butylamino)ethan-1-ol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-aminophenyl)-2-(tert-butylamino)ethanol;hydrochloride (CAS 1082710-41-5) is a chemical compound with the molecular formula C12H21ClN2O and a molecular weight of 244.76 g/mol. IUPAC name: 1-(4-aminophenyl)-2-(tert-butylamino)ethanol;hydrochloride. InChIKey: AFQFVUICIUDMPU-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O |
|---|---|
| Molecular weight | 244.76 g/mol |
| IUPAC name | 1-(4-aminophenyl)-2-(tert-butylamino)ethanol;hydrochloride |
| InChIKey | AFQFVUICIUDMPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC=C(C=C1)N)O.Cl |
Computed by PubChem (NCBI)