Products 1082949-67-4
CAS 1082949-67-4 appears in our catalog under these names: Ly2584702, 95%, LY-2584702 free base, LY2584702, LY 2584702, LY-2584702 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 500mg.
4-[4-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1-methylimidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine (CAS 1082949-67-4) is a chemical compound with the molecular formula C21H19F4N7 and a molecular weight of 445.4 g/mol. IUPAC name: 4-[4-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1-methylimidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine. InChIKey: FYXRSVDHGLUMHB-UHFFFAOYSA-N.
| Molecular formula | C21H19F4N7 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | 4-[4-[4-[4-fluoro-3-(trifluoromethyl)phenyl]-1-methylimidazol-2-yl]piperidin-1-yl]-1H-pyrazolo[5,4-d]pyrimidine |
| InChIKey | FYXRSVDHGLUMHB-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1C2CCN(CC2)C3=NC=NC4=C3C=NN4)C5=CC(=C(C=C5)F)C(F)(F)F |
Computed by PubChem (NCBI)