CAS 1083-36-9 appears in our catalog under these names: Hydrochlorothiazide Impurity 21, 4-Amino-5-chloro-1,3-benzenedisulfonamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-amino-5-chlorobenzene-1,3-disulfonamide (CAS 1083-36-9) is a chemical compound with the molecular formula C6H8ClN3O4S2 and a molecular weight of 285.7 g/mol. IUPAC name: 4-amino-5-chlorobenzene-1,3-disulfonamide. InChIKey: SWTAIRDZECAFHR-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O4S2 |
|---|---|
| Molecular weight | 285.7 g/mol |
| IUPAC name | 4-amino-5-chlorobenzene-1,3-disulfonamide |
| InChIKey | SWTAIRDZECAFHR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1S(=O)(=O)N)N)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)