Products 108312-24-9
CAS 108312-24-9 is the registry number for (S)-4-(tert-Butoxy)-2-(((3-nitropyridin-2-yl)thio)amino)-4-oxobutanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2-methylpropan-2-yl)oxy]-2-[(3-nitro-2-pyridinyl)sulfanylamino]-4-oxobutanoic acid (CAS 108312-24-9) is a chemical compound with the molecular formula C13H17N3O6S and a molecular weight of 343.36 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]-2-[(3-nitro-2-pyridinyl)sulfanylamino]-4-oxobutanoic acid. InChIKey: VTEWXTHQMTVUOZ-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O6S |
|---|---|
| Molecular weight | 343.36 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]-2-[(3-nitro-2-pyridinyl)sulfanylamino]-4-oxobutanoic acid |
| InChIKey | VTEWXTHQMTVUOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)O)NSC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)