CAS 1083175-17-0 is the registry number for 2-Azido-N-(2-azidoethyl)-N-nitrosoethanamine. Offered by: TRC. Available pack sizes: 250mg.
N,N-bis(2-azidoethyl)nitrous amide (CAS 1083175-17-0) is a chemical compound with the molecular formula C4H8N8O and a molecular weight of 184.16 g/mol. IUPAC name: N,N-bis(2-azidoethyl)nitrous amide. InChIKey: RIUZFDCNWKDQLC-UHFFFAOYSA-N.
| Molecular formula | C4H8N8O |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | N,N-bis(2-azidoethyl)nitrous amide |
| InChIKey | RIUZFDCNWKDQLC-UHFFFAOYSA-N |
| SMILES | C(CN(CCN=[N+]=[N-])N=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)