CAS 108321-16-0 is the registry number for H-Phe-leu-nh2 hbr, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrobromide (CAS 108321-16-0) is a chemical compound with the molecular formula C15H24BrN3O2 and a molecular weight of 358.27 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrobromide. InChIKey: SBFSMRHQAGKROZ-QNTKWALQSA-N.
| Molecular formula | C15H24BrN3O2 |
|---|---|
| Molecular weight | 358.27 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanamide;hydrobromide |
| InChIKey | SBFSMRHQAGKROZ-QNTKWALQSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)[C@H](CC1=CC=CC=C1)N.Br |
Computed by PubChem (NCBI)