CAS 108321-19-3 appears in our catalog under these names: (S)–N–(4–Nitrophenyl)pyrrolidine–2–carboxamide 2,2,2–trifluoroacetate, H-L-Pro-pNA Trifluoracetate, H-L-Pro-pNA Trifluoracetate 98%, L-Proline p-nitroanilide trifluoroacetate salt, 98%, 98%, L-Proline p-nitroanilide (TFA), 99.95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25g, 5g, 1g, 2g, 10g, 250mg, 25 g, 5 g.
(2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid (CAS 108321-19-3) is a chemical compound with the molecular formula C13H14F3N3O5 and a molecular weight of 349.26 g/mol. IUPAC name: (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid. InChIKey: KYRVEVYREUUAKH-PPHPATTJSA-N.
| Molecular formula | C13H14F3N3O5 |
|---|---|
| Molecular weight | 349.26 g/mol |
| IUPAC name | (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| InChIKey | KYRVEVYREUUAKH-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-].C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)