CAS 108325-86-6 appears in our catalog under these names: Z-Asp(OSu)-OBzl, Z–Asp(OSu)–OBzl. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g, 50g.
1-O-benzyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate (CAS 108325-86-6) is a chemical compound with the molecular formula C23H22N2O8 and a molecular weight of 454.4 g/mol. IUPAC name: 1-O-benzyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: LXDKEAJZVMCBRR-SFHVURJKSA-N.
| Molecular formula | C23H22N2O8 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | LXDKEAJZVMCBRR-SFHVURJKSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C[C@@H](C(=O)OCC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)