Products 108354-12-7
CAS 108354-12-7 is the registry number for Aurachin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
Aurachin B is an A-type aurachin that is quinoline N-oxide which is substituted by a methyl group at position 2, a hydroxy group at position 3, and a triprenyl group at position 4. It has a role as a bacterial metabolite. It is a quinoline N-oxide, a heteroaryl hydroxy compound, an olefinic compound and an A-type aurachin. It is a conjugate acid of an aurachin B(1-).
Source: ChEBI
| Molecular formula | C25H33NO2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 2-methyl-1-oxido-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]quinolin-1-ium-3-ol |
| InChIKey | ZNSLRZHNFFXDSE-YEFHWUCQSA-N |
| SMILES | CC1=[N+](C2=CC=CC=C2C(=C1O)C/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)[O-] |
Computed by PubChem (NCBI)