CAS 108381-22-2 is the registry number for O-Desmethyl-Pimobendan, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
3-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (CAS 108381-22-2) is a chemical compound with the molecular formula C18H16N4O2 and a molecular weight of 320.3 g/mol. IUPAC name: 3-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one. InChIKey: QOAXSEARPHDXFC-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O2 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 3-[2-(4-hydroxyphenyl)-3H-benzimidazol-5-yl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | QOAXSEARPHDXFC-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)NN=C1C2=CC3=C(C=C2)N=C(N3)C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)