CAS 108436-36-8 appears in our catalog under these names: Ganciclovir EP Impurity C, Ganciclovir Impurity 3(Ganciclovir EP Impurity C), 2-Amino-9-(((1-chloro-3-hydroxypropan-2-yl)oxy)methyl)-3,9-dihydro-6H-purin-6-one, 98%, 2’-Monodehydroxy-2’-chloro Ganciclovir, >95% (HPLC), 2-Amino-9-(((1RS)-2-chloro-1-(hydroxymethyl)ethoxy)methyl)-1,9-dihydro-6H-purin-6-one (Monochloroganciclovir). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-amino-9-[(1-chloro-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one (CAS 108436-36-8) is a chemical compound with the molecular formula C9H12ClN5O3 and a molecular weight of 273.68 g/mol. IUPAC name: 2-amino-9-[(1-chloro-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one. InChIKey: FQZPLTGJIGCMPY-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5O3 |
|---|---|
| Molecular weight | 273.68 g/mol |
| IUPAC name | 2-amino-9-[(1-chloro-3-hydroxypropan-2-yl)oxymethyl]-1H-purin-6-one |
| InChIKey | FQZPLTGJIGCMPY-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1COC(CO)CCl)N=C(NC2=O)N |
Computed by PubChem (NCBI)