Products 108436-61-9

CAS 108436-61-9 is the registry number for Ganciclovir Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-phenylmethoxypropyl] acetate (CAS 108436-61-9) is a chemical compound with the molecular formula C18H21N5O5 and a molecular weight of 387.4 g/mol. IUPAC name: [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-phenylmethoxypropyl] acetate. InChIKey: OVVMBRVBIBXEQP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H21N5O5
Molecular weight387.4 g/mol
IUPAC name[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-phenylmethoxypropyl] acetate
InChIKeyOVVMBRVBIBXEQP-UHFFFAOYSA-N
SMILESCC(=O)OCC(COCC1=CC=CC=C1)OCN2C=NC3=C2N=C(NC3=O)N

Computed by PubChem (NCBI)