Products 108481-44-3
CAS 108481-44-3 appears in our catalog under these names: Dimethyl-d6 Carbonate, Dimethyl-d6 Carbonate, 99 atom % D, min 98% Chemical Purity, Dimethylcarbonate-D6 99,5 atom % D, DIMETHYL-D6 CARBONATE, 99 ATOM % D, 97&, Dimethyl carbonate D6, 99,5 Atom%D, 1 ml, glass. Offered by: TRC, CDN, Deutero, Sigma-Aldrich, Roth. Available pack sizes: 100mg, 1g, 250mg, 0,7ml, 5ml, 10G, 1ml.
Bis(trideuteriomethyl) carbonate (CAS 108481-44-3) is a chemical compound with the molecular formula C3H6O3 and a molecular weight of 96.11 g/mol. IUPAC name: bis(trideuteriomethyl) carbonate. InChIKey: IEJIGPNLZYLLBP-WFGJKAKNSA-N.
| Molecular formula | C3H6O3 |
|---|---|
| Molecular weight | 96.11 g/mol |
| IUPAC name | bis(trideuteriomethyl) carbonate |
| InChIKey | IEJIGPNLZYLLBP-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)