CAS 1084891-96-2 appears in our catalog under these names: Cariprazine N-Oxide, Cariprazine N-Oxide, 98%, 98%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 50mg, 10mg, 25mg.
3-[4-[2-[4-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium-1-yl]ethyl]cyclohexyl]-1,1-dimethylurea (CAS 1084891-96-2) is a chemical compound with the molecular formula C21H32Cl2N4O2 and a molecular weight of 443.4 g/mol. IUPAC name: 3-[4-[2-[4-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium-1-yl]ethyl]cyclohexyl]-1,1-dimethylurea. InChIKey: IJUUVBFNXJVKHK-UHFFFAOYSA-N.
| Molecular formula | C21H32Cl2N4O2 |
|---|---|
| Molecular weight | 443.4 g/mol |
| IUPAC name | 3-[4-[2-[4-(2,3-dichlorophenyl)-1-oxidopiperazin-1-ium-1-yl]ethyl]cyclohexyl]-1,1-dimethylurea |
| InChIKey | IJUUVBFNXJVKHK-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1CCC(CC1)CC[N+]2(CCN(CC2)C3=C(C(=CC=C3)Cl)Cl)[O-] |
Computed by PubChem (NCBI)