CAS 1084904-39-1 appears in our catalog under these names: (2-Isopropoxynaphthalen-1-yl)boronic acid, 95+%, [2-(Propan-2-yloxy)naphthalen-1-yl]boranediol, 95%, 2-(Propan-2-yloxy)naphthalene-1-boronic acid, ≥95%, ≥95%, 2-(Propan-2-yloxy)naphthalene-1-boronic acid. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 250mg, 1g.
(2-propan-2-yloxynaphthalen-1-yl)boronic acid (CAS 1084904-39-1) is a chemical compound with the molecular formula C13H15BO3 and a molecular weight of 230.07 g/mol. IUPAC name: (2-propan-2-yloxynaphthalen-1-yl)boronic acid. InChIKey: YHVDICWVRLAXMV-UHFFFAOYSA-N.
| Molecular formula | C13H15BO3 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | (2-propan-2-yloxynaphthalen-1-yl)boronic acid |
| InChIKey | YHVDICWVRLAXMV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC2=CC=CC=C12)OC(C)C)(O)O |
Computed by PubChem (NCBI)